C11H18N4 — CID 107402995
2-N-(cyclobutylmethyl)-2-N-ethylpyrazine-2,5-diamine (PubChem CID 107402995) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-N-(cyclobutylmethyl)-2-N-ethylpyrazine-2,5-diamine.
| Compound Name | 2-N-(cyclobutylmethyl)-2-N-ethylpyrazine-2,5-diamine |
|---|---|
| PubChem CID | 107402995 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-N-(cyclobutylmethyl)-2-N-ethylpyrazine-2,5-diamine |
| SMILES | CCN(CC1CCC1)c1cnc(N)cn1 |
| InChI | InChI=1S/C11H18N4/c1-2-15(8-9-4-3-5-9)11-7-13-10(12)6-14-11/h6-7,9H,2-5,8H2,1H3,(H2,12,13) |
| InChIKey | JWTGUFDOOFYKSP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |