C12H19N3 — CID 107402993
6-N-(cyclobutylmethyl)-6-N-ethylpyridine-2,6-diamine (PubChem CID 107402993) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 6-N-(cyclobutylmethyl)-6-N-ethylpyridine-2,6-diamine.
| Compound Name | 6-N-(cyclobutylmethyl)-6-N-ethylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 107402993 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 6-N-(cyclobutylmethyl)-6-N-ethylpyridine-2,6-diamine |
| SMILES | CCN(CC1CCC1)c1cccc(N)n1 |
| InChI | InChI=1S/C12H19N3/c1-2-15(9-10-5-3-6-10)12-8-4-7-11(13)14-12/h4,7-8,10H,2-3,5-6,9H2,1H3,(H2,13,14) |
| InChIKey | OWIZMTJFDYQSES-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |