C11H18N4 — CID 80913288
N-(cyclopropylmethyl)-N-ethyl-6-hydrazinylpyridin-2-amine (PubChem CID 80913288) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-ethyl-6-hydrazinylpyridin-2-amine.
| Compound Name | N-(cyclopropylmethyl)-N-ethyl-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 80913288 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | N-(cyclopropylmethyl)-N-ethyl-6-hydrazinylpyridin-2-amine |
| SMILES | CCN(CC1CC1)c1cccc(NN)n1 |
| InChI | InChI=1S/C11H18N4/c1-2-15(8-9-6-7-9)11-5-3-4-10(13-11)14-12/h3-5,9H,2,6-8,12H2,1H3,(H,13,14) |
| InChIKey | XNQSONMLHIBPEZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|