C12H19N3O — CID 80646622
6-N-ethyl-6-N-(oxolan-2-ylmethyl)pyridine-2,6-diamine (PubChem CID 80646622) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 6-N-ethyl-6-N-(oxolan-2-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-ethyl-6-N-(oxolan-2-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80646622 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 6-N-ethyl-6-N-(oxolan-2-ylmethyl)pyridine-2,6-diamine |
| SMILES | CCN(CC1CCCO1)c1cccc(N)n1 |
| InChI | InChI=1S/C12H19N3O/c1-2-15(9-10-5-4-8-16-10)12-7-3-6-11(13)14-12/h3,6-7,10H,2,4-5,8-9H2,1H3,(H2,13,14) |
| InChIKey | OKMRVJBSGMSQBQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |