C14H17ClN2O — CID 113389720
2-[1-[[4-(1-aminoethyl)-2-chlorophenoxy]methyl]cyclopropyl]acetonitrile (PubChem CID 113389720) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 2-[1-[[4-(1-aminoethyl)-2-chlorophenoxy]methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[[4-(1-aminoethyl)-2-chlorophenoxy]methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 113389720 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-[1-[[4-(1-aminoethyl)-2-chlorophenoxy]methyl]cyclopropyl]acetonitrile |
| SMILES | CC(N)c1ccc(OCC2(CC#N)CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClN2O/c1-10(17)11-2-3-13(12(15)8-11)18-9-14(4-5-14)6-7-16/h2-3,8,10H,4-6,9,17H2,1H3 |
| InChIKey | IIEIYVCNCCOOJU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |