C14H16FNO2 — CID 113389661
2-[1-[[2-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]methyl]cyclopropyl]acetonitrile (PubChem CID 113389661) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is 2-[1-[[2-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[[2-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 113389661 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-[1-[[2-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]methyl]cyclopropyl]acetonitrile |
| SMILES | C[C@H](O)c1ccc(OCC2(CC#N)CC2)c(F)c1 |
| InChI | InChI=1S/C14H16FNO2/c1-10(17)11-2-3-13(12(15)8-11)18-9-14(4-5-14)6-7-16/h2-3,8,10,17H,4-6,9H2,1H3/t10-/m0/s1 |
| InChIKey | GVOIGYVKBIAINU-JTQLQIEISA-N |
| XLogP | 2.95 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |