C12H13ClN2O2 — CID 113389763
(1R)-1-[3-chloro-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine (PubChem CID 113389763) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[3-chloro-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 113389763 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (1R)-1-[3-chloro-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(OCc2ccno2)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O2/c1-8(14)9-2-3-12(11(13)6-9)16-7-10-4-5-15-17-10/h2-6,8H,7,14H2,1H3/t8-/m1/s1 |
| InChIKey | YFCSNQWXBGTXTN-MRVPVSSYSA-N |
| XLogP | 2.93 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |