C13H15NO4 — CID 43503809
1-[3-methoxy-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanol (PubChem CID 43503809) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-[3-methoxy-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanol.
| Compound Name | 1-[3-methoxy-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 43503809 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-[3-methoxy-4-(1,2-oxazol-5-ylmethoxy)phenyl]ethanol |
| SMILES | COc1cc(C(C)O)ccc1OCc1ccno1 |
| InChI | InChI=1S/C13H15NO4/c1-9(15)10-3-4-12(13(7-10)16-2)17-8-11-5-6-14-18-11/h3-7,9,15H,8H2,1-2H3 |
| InChIKey | INDLZPFBBPCLRG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |