C12H15N3O2S — CID 113391152
5-[3-(oxan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]thiophen-2-amine (PubChem CID 113391152) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 5-[3-(oxan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]thiophen-2-amine.
| Compound Name | 5-[3-(oxan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]thiophen-2-amine |
|---|---|
| PubChem CID | 113391152 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-[3-(oxan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]thiophen-2-amine |
| SMILES | Nc1ccc(-c2nc(CC3CCCCO3)no2)s1 |
| InChI | InChI=1S/C12H15N3O2S/c13-10-5-4-9(18-10)12-14-11(15-17-12)7-8-3-1-2-6-16-8/h4-5,8H,1-3,6-7,13H2 |
| InChIKey | CGDWZNCUDWMVPZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |