C17H14Cl2N4O3S — CID 11339286
8-chloro-4-[(5-chloro-3-pyridinyl)amino]-6-ethylsulfonylquinoline-3-carboxamide (PubChem CID 11339286) has the molecular formula C17H14Cl2N4O3S and a molecular weight of 425.30 g/mol. Its IUPAC name is 8-chloro-4-[(5-chloro-3-pyridinyl)amino]-6-ethylsulfonylquinoline-3-carboxamide.
| Compound Name | 8-chloro-4-[(5-chloro-3-pyridinyl)amino]-6-ethylsulfonylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11339286 |
| Molecular Formula | C17H14Cl2N4O3S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 8-chloro-4-[(5-chloro-3-pyridinyl)amino]-6-ethylsulfonylquinoline-3-carboxamide |
| SMILES | CCS(=O)(=O)c1cc(Cl)c2ncc(C(N)=O)c(Nc3cncc(Cl)c3)c2c1 |
| InChI | InChI=1S/C17H14Cl2N4O3S/c1-2-27(25,26)11-4-12-15(23-10-3-9(18)6-21-7-10)13(17(20)24)8-22-16(12)14(19)5-11/h3-8H,2H2,1H3,(H2,20,24)(H,22,23) |
| InChIKey | OKDDUBQKSPRZBO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |