C14H16N2O — CID 113395406
2-quinolin-4-yloxycyclopentan-1-amine (PubChem CID 113395406) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-quinolin-4-yloxycyclopentan-1-amine.
| Compound Name | 2-quinolin-4-yloxycyclopentan-1-amine |
|---|---|
| PubChem CID | 113395406 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-quinolin-4-yloxycyclopentan-1-amine |
| SMILES | NC1CCCC1Oc1ccnc2ccccc12 |
| InChI | InChI=1S/C14H16N2O/c15-11-5-3-7-14(11)17-13-8-9-16-12-6-2-1-4-10(12)13/h1-2,4,6,8-9,11,14H,3,5,7,15H2 |
| InChIKey | OUIZBCKUQMNGEA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |