C12H9Br2FN2 — CID 113398572
(3,5-dibromo-2-pyridinyl)-(3-fluorophenyl)methanamine (PubChem CID 113398572) has the molecular formula C12H9Br2FN2 and a molecular weight of 360.02 g/mol. Its IUPAC name is (3,5-dibromo-2-pyridinyl)-(3-fluorophenyl)methanamine.
| Compound Name | (3,5-dibromo-2-pyridinyl)-(3-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 113398572 |
| Molecular Formula | C12H9Br2FN2 |
| Molecular Weight | 360.02 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | (3,5-dibromo-2-pyridinyl)-(3-fluorophenyl)methanamine |
| SMILES | NC(c1cccc(F)c1)c1ncc(Br)cc1Br |
| InChI | InChI=1S/C12H9Br2FN2/c13-8-5-10(14)12(17-6-8)11(16)7-2-1-3-9(15)4-7/h1-6,11H,16H2 |
| InChIKey | DLGABJKQAFFIFU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.02 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |