C11H12FN3O2S — CID 113399778
4-(4-ethoxy-3-fluorophenyl)-3-(hydroxymethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 113399778) has the molecular formula C11H12FN3O2S and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-(4-ethoxy-3-fluorophenyl)-3-(hydroxymethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-ethoxy-3-fluorophenyl)-3-(hydroxymethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 113399778 |
| Molecular Formula | C11H12FN3O2S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 4-(4-ethoxy-3-fluorophenyl)-3-(hydroxymethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1ccc(-n2c(CO)n[nH]c2=S)cc1F |
| InChI | InChI=1S/C11H12FN3O2S/c1-2-17-9-4-3-7(5-8(9)12)15-10(6-16)13-14-11(15)18/h3-5,16H,2,6H2,1H3,(H,14,18) |
| InChIKey | QSRLAFPPIUTCQP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|