C11H19N3O2S — CID 113401747
3-[6-amino-2-(ethoxymethyl)pyrimidin-4-yl]sulfanylbutan-1-ol (PubChem CID 113401747) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-[6-amino-2-(ethoxymethyl)pyrimidin-4-yl]sulfanylbutan-1-ol.
| Compound Name | 3-[6-amino-2-(ethoxymethyl)pyrimidin-4-yl]sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 113401747 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-[6-amino-2-(ethoxymethyl)pyrimidin-4-yl]sulfanylbutan-1-ol |
| SMILES | CCOCc1nc(N)cc(SC(C)CCO)n1 |
| InChI | InChI=1S/C11H19N3O2S/c1-3-16-7-10-13-9(12)6-11(14-10)17-8(2)4-5-15/h6,8,15H,3-5,7H2,1-2H3,(H2,12,13,14) |
| InChIKey | HGZJGCYKWNCJIZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |