C12H17ClN6O — CID 113401955
[6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(ethoxymethyl)pyrimidin-4-yl]hydrazine (PubChem CID 113401955) has the molecular formula C12H17ClN6O and a molecular weight of 296.76 g/mol. Its IUPAC name is [6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(ethoxymethyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(ethoxymethyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 113401955 |
| Molecular Formula | C12H17ClN6O |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-(ethoxymethyl)pyrimidin-4-yl]hydrazine |
| SMILES | CCOCc1nc(NN)cc(-n2nc(C)c(Cl)c2C)n1 |
| InChI | InChI=1S/C12H17ClN6O/c1-4-20-6-10-15-9(17-14)5-11(16-10)19-8(3)12(13)7(2)18-19/h5H,4,6,14H2,1-3H3,(H,15,16,17) |
| InChIKey | IWTJLZNBGRDVNS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|