C12H21N5O3S — CID 102887920
[2-(ethoxymethyl)-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]hydrazine (PubChem CID 102887920) has the molecular formula C12H21N5O3S and a molecular weight of 315.40 g/mol. Its IUPAC name is [2-(ethoxymethyl)-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(ethoxymethyl)-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 102887920 |
| Molecular Formula | C12H21N5O3S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | [2-(ethoxymethyl)-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]hydrazine |
| SMILES | CCOCc1nc(NN)cc(N2CCS(=O)(=O)CC2C)n1 |
| InChI | InChI=1S/C12H21N5O3S/c1-3-20-7-11-14-10(16-13)6-12(15-11)17-4-5-21(18,19)8-9(17)2/h6,9H,3-5,7-8,13H2,1-2H3,(H,14,15,16) |
| InChIKey | SDWWBYZOHKNBJF-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|