About methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate
methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate (PubChem CID 113402196) has the molecular formula C12H23N3O3
and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate |
| PubChem CID | 113402196 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate |
| SMILES | COC(=O)NC1CCN(C(=O)C(N)C(C)(C)C)C1 |
| InChI | InChI=1S/C12H23N3O3/c1-12(2,3)9(13)10(16)15-6-5-8(7-15)14-11(17)18-4/h8-9H,5-7,13H2,1-4H3,(H,14,17) |
| InChIKey | HJRLHZORDVUJOT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate?
The IUPAC name of methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate (CID 113402196) is methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate.
What is the SMILES notation for methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate?
The canonical SMILES for methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate is COC(=O)NC1CCN(C(=O)C(N)C(C)(C)C)C1.
What is the InChIKey of methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate?
The InChIKey is HJRLHZORDVUJOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O3/c1-12(2,3)9(13)10(16)15-6-5-8(7-15)14-11(17)18-4/h8-9H,5-7,13H2,1-4H3,(H,14,17).
What are the key properties of methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate?
methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate has a molecular weight of 257.33 g/mol, XLogP of 0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1-(2-amino-3,3-dimethylbutanoyl)pyrrolidin-3-yl]carbamate is sourced from PubChem (CID 113402196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).