About methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate
methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate (PubChem CID 113402577) has the molecular formula C9H15F3N2O3
and a molecular weight of 256.22 g/mol. Its IUPAC name is methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate |
| PubChem CID | 113402577 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate |
| SMILES | COC(=O)NC1CCN(CC(O)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2O3/c1-17-8(16)13-6-2-3-14(4-6)5-7(15)9(10,11)12/h6-7,15H,2-5H2,1H3,(H,13,16) |
| InChIKey | KECBKARLXJXYFO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate?
The IUPAC name of methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate (CID 113402577) is methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate.
What is the SMILES notation for methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate?
The canonical SMILES for methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate is COC(=O)NC1CCN(CC(O)C(F)(F)F)C1.
What is the InChIKey of methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate?
The InChIKey is KECBKARLXJXYFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O3/c1-17-8(16)13-6-2-3-14(4-6)5-7(15)9(10,11)12/h6-7,15H,2-5H2,1H3,(H,13,16).
What are the key properties of methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate?
methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate has a molecular weight of 256.22 g/mol, XLogP of 0.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrrolidin-3-yl]carbamate is sourced from PubChem (CID 113402577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).