C13H25BrN2O2 — CID 113402602
methyl N-[1-[2-(bromomethyl)-2-ethylbutyl]pyrrolidin-3-yl]carbamate (PubChem CID 113402602) has the molecular formula C13H25BrN2O2 and a molecular weight of 321.26 g/mol. Its IUPAC name is methyl N-[1-[2-(bromomethyl)-2-ethylbutyl]pyrrolidin-3-yl]carbamate.
| Compound Name | methyl N-[1-[2-(bromomethyl)-2-ethylbutyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 113402602 |
| Molecular Formula | C13H25BrN2O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | methyl N-[1-[2-(bromomethyl)-2-ethylbutyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCC(CC)(CBr)CN1CCC(NC(=O)OC)C1 |
| InChI | InChI=1S/C13H25BrN2O2/c1-4-13(5-2,9-14)10-16-7-6-11(8-16)15-12(17)18-3/h11H,4-10H2,1-3H3,(H,15,17) |
| InChIKey | SUDMYRITJLKEOP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|