C23H25FN4O2S2 — CID 11340432
3-[1-(4-fluorobenzoyl)piperidin-4-yl]-1-propan-2-yl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea (PubChem CID 11340432) has the molecular formula C23H25FN4O2S2 and a molecular weight of 472.61 g/mol. Its IUPAC name is 3-[1-(4-fluorobenzoyl)piperidin-4-yl]-1-propan-2-yl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea.
| Compound Name | 3-[1-(4-fluorobenzoyl)piperidin-4-yl]-1-propan-2-yl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 11340432 |
| Molecular Formula | C23H25FN4O2S2 |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 3-[1-(4-fluorobenzoyl)piperidin-4-yl]-1-propan-2-yl-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea |
| SMILES | CC(C)N(C(=O)NC1CCN(C(=O)c2ccc(F)cc2)CC1)c1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C23H25FN4O2S2/c1-14(2)28(18-7-8-19-20(13-18)32-23(31)26-19)22(30)25-17-9-11-27(12-10-17)21(29)15-3-5-16(24)6-4-15/h3-8,13-14,17H,9-12H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | VYRLSRBDLGAWPE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|