C21H25FN4OS — CID 155161681
2-[4-(dimethylamino)phenyl]-1-[4-(4-fluoro-2,3-dihydro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone (PubChem CID 155161681) has the molecular formula C21H25FN4OS and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-1-[4-(4-fluoro-2,3-dihydro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(dimethylamino)phenyl]-1-[4-(4-fluoro-2,3-dihydro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 155161681 |
| Molecular Formula | C21H25FN4OS |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-1-[4-(4-fluoro-2,3-dihydro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone |
| SMILES | CN(C)c1ccc(CC(=O)N2CCN(C3Nc4c(F)cccc4S3)CC2)cc1 |
| InChI | InChI=1S/C21H25FN4OS/c1-24(2)16-8-6-15(7-9-16)14-19(27)25-10-12-26(13-11-25)21-23-20-17(22)4-3-5-18(20)28-21/h3-9,21,23H,10-14H2,1-2H3 |
| InChIKey | ORTBMGJTPUELKB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|