C12H13ClN2O2S — CID 113404475
6-chloro-5-propyl-3-(thiophen-2-ylmethyl)-1H-pyrimidine-2,4-dione (PubChem CID 113404475) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is 6-chloro-5-propyl-3-(thiophen-2-ylmethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-5-propyl-3-(thiophen-2-ylmethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 113404475 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 6-chloro-5-propyl-3-(thiophen-2-ylmethyl)-1H-pyrimidine-2,4-dione |
| SMILES | CCCc1c(Cl)[nH]c(=O)n(Cc2cccs2)c1=O |
| InChI | InChI=1S/C12H13ClN2O2S/c1-2-4-9-10(13)14-12(17)15(11(9)16)7-8-5-3-6-18-8/h3,5-6H,2,4,7H2,1H3,(H,14,17) |
| InChIKey | PKYLATFXWHLPMA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |