C14H24N2O — CID 113405276
N-[(4-ethoxyphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 113405276) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 113405276 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CCOc1ccc(CNCCNC(C)C)cc1 |
| InChI | InChI=1S/C14H24N2O/c1-4-17-14-7-5-13(6-8-14)11-15-9-10-16-12(2)3/h5-8,12,15-16H,4,9-11H2,1-3H3 |
| InChIKey | PQQMSJBNABMDIN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|