C12H23N3O2 — CID 113407095
2-amino-N-[1-(cyclopropylamino)-1-oxopropan-2-yl]-3-methylpentanamide (PubChem CID 113407095) has the molecular formula C12H23N3O2 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-amino-N-[1-(cyclopropylamino)-1-oxopropan-2-yl]-3-methylpentanamide.
| Compound Name | 2-amino-N-[1-(cyclopropylamino)-1-oxopropan-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 113407095 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2-amino-N-[1-(cyclopropylamino)-1-oxopropan-2-yl]-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)NC(C)C(=O)NC1CC1 |
| InChI | InChI=1S/C12H23N3O2/c1-4-7(2)10(13)12(17)14-8(3)11(16)15-9-5-6-9/h7-10H,4-6,13H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | GFYUSNKPMKMWBU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |