C23H31N6O4S+ — CID 11340731
(Z)-2-hydroxy-3-[[2-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-phenylpropanoyl]amino]but-1-ene-1-diazonium (PubChem CID 11340731) has the molecular formula C23H31N6O4S+ and a molecular weight of 487.61 g/mol. Its IUPAC name is (Z)-2-hydroxy-3-[[2-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-phenylpropanoyl]amino]but-1-ene-1-diazonium.
| Compound Name | (Z)-2-hydroxy-3-[[2-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-phenylpropanoyl]amino]but-1-ene-1-diazonium |
|---|---|
| PubChem CID | 11340731 |
| Molecular Formula | C23H31N6O4S+ |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | (Z)-2-hydroxy-3-[[2-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-phenylpropanoyl]amino]but-1-ene-1-diazonium |
| SMILES | CC(NC(=O)C(Cc1ccccc1)NC(=O)CCCC[C@@H]1SCC2NC(=O)NC21)/C(O)=C/[N+]#N |
| InChI | InChI=1S/C23H30N6O4S/c1-14(18(30)12-25-24)26-22(32)16(11-15-7-3-2-4-8-15)27-20(31)10-6-5-9-19-21-17(13-34-19)28-23(33)29-21/h2-4,7-8,12,14,16-17,19,21H,5-6,9-11,13H2,1H3,(H4-,26,27,28,29,30,31,32,33)/p+1/b18-12-/t14?,16?,17?,19-,21?/m0/s1 |
| InChIKey | QZMMICCPVJYJJW-KUANIHHGSA-O |
| XLogP | 2.20 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|