C14H22Cl2N2 — CID 113410442
N'-tert-butyl-N-[(2,5-dichlorophenyl)methyl]propane-1,3-diamine (PubChem CID 113410442) has the molecular formula C14H22Cl2N2 and a molecular weight of 289.25 g/mol. Its IUPAC name is N'-tert-butyl-N-[(2,5-dichlorophenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-tert-butyl-N-[(2,5-dichlorophenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 113410442 |
| Molecular Formula | C14H22Cl2N2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N'-tert-butyl-N-[(2,5-dichlorophenyl)methyl]propane-1,3-diamine |
| SMILES | CC(C)(C)NCCCNCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H22Cl2N2/c1-14(2,3)18-8-4-7-17-10-11-9-12(15)5-6-13(11)16/h5-6,9,17-18H,4,7-8,10H2,1-3H3 |
| InChIKey | PHTFUKNYPQOVLG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|