C11H12ClN5S — CID 113412853
3-chloro-4-[2-(triazol-1-yl)ethylamino]benzenecarbothioamide (PubChem CID 113412853) has the molecular formula C11H12ClN5S and a molecular weight of 281.77 g/mol. Its IUPAC name is 3-chloro-4-[2-(triazol-1-yl)ethylamino]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[2-(triazol-1-yl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 113412853 |
| Molecular Formula | C11H12ClN5S |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-chloro-4-[2-(triazol-1-yl)ethylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCCn2ccnn2)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClN5S/c12-9-7-8(11(13)18)1-2-10(9)14-3-5-17-6-4-15-16-17/h1-2,4,6-7,14H,3,5H2,(H2,13,18) |
| InChIKey | RZPNICATZQYRDM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|