C11H18BrN3O2 — CID 113420435
1-[(5-amino-3-bromo-4-methyl-2-pyridinyl)-methylamino]-3-methoxypropan-2-ol (PubChem CID 113420435) has the molecular formula C11H18BrN3O2 and a molecular weight of 304.19 g/mol. Its IUPAC name is 1-[(5-amino-3-bromo-4-methyl-2-pyridinyl)-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[(5-amino-3-bromo-4-methyl-2-pyridinyl)-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 113420435 |
| Molecular Formula | C11H18BrN3O2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1-[(5-amino-3-bromo-4-methyl-2-pyridinyl)-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)c1ncc(N)c(C)c1Br |
| InChI | InChI=1S/C11H18BrN3O2/c1-7-9(13)4-14-11(10(7)12)15(2)5-8(16)6-17-3/h4,8,16H,5-6,13H2,1-3H3 |
| InChIKey | BBGAUTNKVSRANR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |