About N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine
N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine (PubChem CID 113420784) has the molecular formula C14H17BrN2
and a molecular weight of 293.21 g/mol. Its IUPAC name is N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine |
| PubChem CID | 113420784 |
| Molecular Formula | C14H17BrN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine |
| SMILES | Cc1[nH]c2c(C)cc(Br)cc2c1CNC1CC1 |
| InChI | InChI=1S/C14H17BrN2/c1-8-5-10(15)6-12-13(7-16-11-3-4-11)9(2)17-14(8)12/h5-6,11,16-17H,3-4,7H2,1-2H3 |
| InChIKey | KZNUVHUXJACALD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine?
The IUPAC name of N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine (CID 113420784) is N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine.
What is the SMILES notation for N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine?
The canonical SMILES for N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine is Cc1[nH]c2c(C)cc(Br)cc2c1CNC1CC1.
What is the InChIKey of N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine?
The InChIKey is KZNUVHUXJACALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2/c1-8-5-10(15)6-12-13(7-16-11-3-4-11)9(2)17-14(8)12/h5-6,11,16-17H,3-4,7H2,1-2H3.
What are the key properties of N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine?
N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine has a molecular weight of 293.21 g/mol, XLogP of 3.80, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine is sourced from PubChem (CID 113420784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).