C14H17BrN2 — CID 113420784
N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine (PubChem CID 113420784) has the molecular formula C14H17BrN2 and a molecular weight of 293.21 g/mol. Its IUPAC name is N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine.
| Compound Name | N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 113420784 |
| Molecular Formula | C14H17BrN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-[(5-bromo-2,7-dimethyl-1H-indol-3-yl)methyl]cyclopropanamine |
| SMILES | Cc1[nH]c2c(C)cc(Br)cc2c1CNC1CC1 |
| InChI | InChI=1S/C14H17BrN2/c1-8-5-10(15)6-12-13(7-16-11-3-4-11)9(2)17-14(8)12/h5-6,11,16-17H,3-4,7H2,1-2H3 |
| InChIKey | KZNUVHUXJACALD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|