C13H14Cl2N2 — CID 65335148
N-[(5,7-dichloro-2-methyl-1H-indol-3-yl)methyl]cyclopropanamine (PubChem CID 65335148) has the molecular formula C13H14Cl2N2 and a molecular weight of 269.17 g/mol. Its IUPAC name is N-[(5,7-dichloro-2-methyl-1H-indol-3-yl)methyl]cyclopropanamine.
| Compound Name | N-[(5,7-dichloro-2-methyl-1H-indol-3-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65335148 |
| Molecular Formula | C13H14Cl2N2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | N-[(5,7-dichloro-2-methyl-1H-indol-3-yl)methyl]cyclopropanamine |
| SMILES | Cc1[nH]c2c(Cl)cc(Cl)cc2c1CNC1CC1 |
| InChI | InChI=1S/C13H14Cl2N2/c1-7-11(6-16-9-2-3-9)10-4-8(14)5-12(15)13(10)17-7/h4-5,9,16-17H,2-3,6H2,1H3 |
| InChIKey | PGJZIVHQPKWIHO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|