C16H14Cl3N — CID 105350078
N-[[2-(2,4,6-trichlorophenyl)phenyl]methyl]cyclopropanamine (PubChem CID 105350078) has the molecular formula C16H14Cl3N and a molecular weight of 326.65 g/mol. Its IUPAC name is N-[[2-(2,4,6-trichlorophenyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(2,4,6-trichlorophenyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 105350078 |
| Molecular Formula | C16H14Cl3N |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | N-[[2-(2,4,6-trichlorophenyl)phenyl]methyl]cyclopropanamine |
| SMILES | Clc1cc(Cl)c(-c2ccccc2CNC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl3N/c17-11-7-14(18)16(15(19)8-11)13-4-2-1-3-10(13)9-20-12-5-6-12/h1-4,7-8,12,20H,5-6,9H2 |
| InChIKey | UDOFELVYEPCCHB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |