C16H13Cl4N — CID 63424961
N-[[2-(2,3,5,6-tetrachlorophenyl)phenyl]methyl]cyclopropanamine (PubChem CID 63424961) has the molecular formula C16H13Cl4N and a molecular weight of 361.10 g/mol. Its IUPAC name is N-[[2-(2,3,5,6-tetrachlorophenyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(2,3,5,6-tetrachlorophenyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 63424961 |
| Molecular Formula | C16H13Cl4N |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | N-[[2-(2,3,5,6-tetrachlorophenyl)phenyl]methyl]cyclopropanamine |
| SMILES | Clc1cc(Cl)c(Cl)c(-c2ccccc2CNC2CC2)c1Cl |
| InChI | InChI=1S/C16H13Cl4N/c17-12-7-13(18)16(20)14(15(12)19)11-4-2-1-3-9(11)8-21-10-5-6-10/h1-4,7,10,21H,5-6,8H2 |
| InChIKey | FLBGGMBBNBUKTQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|