C16H15ClFN — CID 115504969
N-[[2-(2-chloro-4-fluorophenyl)phenyl]methyl]cyclopropanamine (PubChem CID 115504969) has the molecular formula C16H15ClFN and a molecular weight of 275.75 g/mol. Its IUPAC name is N-[[2-(2-chloro-4-fluorophenyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(2-chloro-4-fluorophenyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 115504969 |
| Molecular Formula | C16H15ClFN |
| Molecular Weight | 275.75 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-[[2-(2-chloro-4-fluorophenyl)phenyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(-c2ccccc2CNC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C16H15ClFN/c17-16-9-12(18)5-8-15(16)14-4-2-1-3-11(14)10-19-13-6-7-13/h1-5,8-9,13,19H,6-7,10H2 |
| InChIKey | KUOBKDVVVOYJBQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |