C16H16FNO — CID 43283337
N-[[2-(3-fluorophenoxy)phenyl]methyl]cyclopropanamine (PubChem CID 43283337) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is N-[[2-(3-fluorophenoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(3-fluorophenoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43283337 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[[2-(3-fluorophenoxy)phenyl]methyl]cyclopropanamine |
| SMILES | Fc1cccc(Oc2ccccc2CNC2CC2)c1 |
| InChI | InChI=1S/C16H16FNO/c17-13-5-3-6-15(10-13)19-16-7-2-1-4-12(16)11-18-14-8-9-14/h1-7,10,14,18H,8-9,11H2 |
| InChIKey | DGCHLPGRGNFFBI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |