C15H14F2N2O — CID 105391271
N-[[3-fluoro-2-(3-fluorophenoxy)-4-pyridinyl]methyl]cyclopropanamine (PubChem CID 105391271) has the molecular formula C15H14F2N2O and a molecular weight of 276.29 g/mol. Its IUPAC name is N-[[3-fluoro-2-(3-fluorophenoxy)-4-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-fluoro-2-(3-fluorophenoxy)-4-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 105391271 |
| Molecular Formula | C15H14F2N2O |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-[[3-fluoro-2-(3-fluorophenoxy)-4-pyridinyl]methyl]cyclopropanamine |
| SMILES | Fc1cccc(Oc2nccc(CNC3CC3)c2F)c1 |
| InChI | InChI=1S/C15H14F2N2O/c16-11-2-1-3-13(8-11)20-15-14(17)10(6-7-18-15)9-19-12-4-5-12/h1-3,6-8,12,19H,4-5,9H2 |
| InChIKey | DWYJWPZGRWRTLA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |