C17H17ClFNO — CID 102615167
N-[[2-[(2-chloro-5-fluorophenyl)methoxy]phenyl]methyl]cyclopropanamine (PubChem CID 102615167) has the molecular formula C17H17ClFNO and a molecular weight of 305.78 g/mol. Its IUPAC name is N-[[2-[(2-chloro-5-fluorophenyl)methoxy]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-[(2-chloro-5-fluorophenyl)methoxy]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 102615167 |
| Molecular Formula | C17H17ClFNO |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[[2-[(2-chloro-5-fluorophenyl)methoxy]phenyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(Cl)c(COc2ccccc2CNC2CC2)c1 |
| InChI | InChI=1S/C17H17ClFNO/c18-16-8-5-14(19)9-13(16)11-21-17-4-2-1-3-12(17)10-20-15-6-7-15/h1-5,8-9,15,20H,6-7,10-11H2 |
| InChIKey | IRDNBVRLFFGDOO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |