C12H15Cl2NO2S — CID 113422574
2-[1-chloro-2-(3-chloro-4-pyridinyl)ethyl]thiane 1,1-dioxide (PubChem CID 113422574) has the molecular formula C12H15Cl2NO2S and a molecular weight of 308.23 g/mol. Its IUPAC name is 2-[1-chloro-2-(3-chloro-4-pyridinyl)ethyl]thiane 1,1-dioxide.
| Compound Name | 2-[1-chloro-2-(3-chloro-4-pyridinyl)ethyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 113422574 |
| Molecular Formula | C12H15Cl2NO2S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-[1-chloro-2-(3-chloro-4-pyridinyl)ethyl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1C(Cl)Cc1ccncc1Cl |
| InChI | InChI=1S/C12H15Cl2NO2S/c13-10(7-9-4-5-15-8-11(9)14)12-3-1-2-6-18(12,16)17/h4-5,8,10,12H,1-3,6-7H2 |
| InChIKey | HCHADLKFWLJEIO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|