C12H15BrClNO — CID 112656195
4-[2-bromo-2-(oxan-2-yl)ethyl]-3-chloropyridine (PubChem CID 112656195) has the molecular formula C12H15BrClNO and a molecular weight of 304.61 g/mol. Its IUPAC name is 4-[2-bromo-2-(oxan-2-yl)ethyl]-3-chloropyridine.
| Compound Name | 4-[2-bromo-2-(oxan-2-yl)ethyl]-3-chloropyridine |
|---|---|
| PubChem CID | 112656195 |
| Molecular Formula | C12H15BrClNO |
| Molecular Weight | 304.61 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 4-[2-bromo-2-(oxan-2-yl)ethyl]-3-chloropyridine |
| SMILES | Clc1cnccc1CC(Br)C1CCCCO1 |
| InChI | InChI=1S/C12H15BrClNO/c13-10(12-3-1-2-6-16-12)7-9-4-5-15-8-11(9)14/h4-5,8,10,12H,1-3,6-7H2 |
| InChIKey | LSIRYVHXQJVMBC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|