C13H15BrClF2N — CID 114226792
4-[2-bromo-2-(3,3-difluorocyclohexyl)ethyl]-3-chloropyridine (PubChem CID 114226792) has the molecular formula C13H15BrClF2N and a molecular weight of 338.62 g/mol. Its IUPAC name is 4-[2-bromo-2-(3,3-difluorocyclohexyl)ethyl]-3-chloropyridine.
| Compound Name | 4-[2-bromo-2-(3,3-difluorocyclohexyl)ethyl]-3-chloropyridine |
|---|---|
| PubChem CID | 114226792 |
| Molecular Formula | C13H15BrClF2N |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 4-[2-bromo-2-(3,3-difluorocyclohexyl)ethyl]-3-chloropyridine |
| SMILES | FC1(F)CCCC(C(Br)Cc2ccncc2Cl)C1 |
| InChI | InChI=1S/C13H15BrClF2N/c14-11(6-9-3-5-18-8-12(9)15)10-2-1-4-13(16,17)7-10/h3,5,8,10-11H,1-2,4,6-7H2 |
| InChIKey | FRYCDQUDORZJLU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|