C13H13N3O2 — CID 113422630
2-[(5-methoxyindol-1-yl)methyl]-5-methyl-1,3,4-oxadiazole (PubChem CID 113422630) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-[(5-methoxyindol-1-yl)methyl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[(5-methoxyindol-1-yl)methyl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 113422630 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-[(5-methoxyindol-1-yl)methyl]-5-methyl-1,3,4-oxadiazole |
| SMILES | COc1ccc2c(ccn2Cc2nnc(C)o2)c1 |
| InChI | InChI=1S/C13H13N3O2/c1-9-14-15-13(18-9)8-16-6-5-10-7-11(17-2)3-4-12(10)16/h3-7H,8H2,1-2H3 |
| InChIKey | WOVSGVKNVVXQCF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |