C13H12N2O2 — CID 116619426
5-[(5-methoxyindol-1-yl)methyl]-1,2-oxazole (PubChem CID 116619426) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 5-[(5-methoxyindol-1-yl)methyl]-1,2-oxazole.
| Compound Name | 5-[(5-methoxyindol-1-yl)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 116619426 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 5-[(5-methoxyindol-1-yl)methyl]-1,2-oxazole |
| SMILES | COc1ccc2c(ccn2Cc2ccno2)c1 |
| InChI | InChI=1S/C13H12N2O2/c1-16-11-2-3-13-10(8-11)5-7-15(13)9-12-4-6-14-17-12/h2-8H,9H2,1H3 |
| InChIKey | JVJWGUNTYVVGIF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 40.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |