C15H17NO3 — CID 113422755
(Z)-3-methyl-4-(1-oxo-4,5-dihydro-3H-2-benzazepin-2-yl)but-2-enoic acid (PubChem CID 113422755) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (Z)-3-methyl-4-(1-oxo-4,5-dihydro-3H-2-benzazepin-2-yl)but-2-enoic acid.
| Compound Name | (Z)-3-methyl-4-(1-oxo-4,5-dihydro-3H-2-benzazepin-2-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 113422755 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (Z)-3-methyl-4-(1-oxo-4,5-dihydro-3H-2-benzazepin-2-yl)but-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)CN1CCCc2ccccc2C1=O |
| InChI | InChI=1S/C15H17NO3/c1-11(9-14(17)18)10-16-8-4-6-12-5-2-3-7-13(12)15(16)19/h2-3,5,7,9H,4,6,8,10H2,1H3,(H,17,18)/b11-9- |
| InChIKey | RKKCJXABRMSCGO-LUAWRHEFSA-N |
| XLogP | 2.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|