About 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine
5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine (PubChem CID 113423563) has the molecular formula C15H21BrN2
and a molecular weight of 309.25 g/mol. Its IUPAC name is 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine |
| PubChem CID | 113423563 |
| Molecular Formula | C15H21BrN2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine |
| SMILES | CC12CCC(C1)C(C)(C)C2Nc1cncc(Br)c1 |
| InChI | InChI=1S/C15H21BrN2/c1-14(2)10-4-5-15(3,7-10)13(14)18-12-6-11(16)8-17-9-12/h6,8-10,13,18H,4-5,7H2,1-3H3 |
| InChIKey | WPBQKLBALQQIGM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine?
The IUPAC name of 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine (CID 113423563) is 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine.
What is the SMILES notation for 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine?
The canonical SMILES for 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine is CC12CCC(C1)C(C)(C)C2Nc1cncc(Br)c1.
What is the InChIKey of 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine?
The InChIKey is WPBQKLBALQQIGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrN2/c1-14(2)10-4-5-15(3,7-10)13(14)18-12-6-11(16)8-17-9-12/h6,8-10,13,18H,4-5,7H2,1-3H3.
What are the key properties of 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine?
5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine has a molecular weight of 309.25 g/mol, XLogP of 4.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)pyridin-3-amine is sourced from PubChem (CID 113423563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).