C10H9FN2O5S — CID 113427829
2-[2-(3-fluoro-4-nitroanilino)-2-oxoethyl]sulfanylacetic acid (PubChem CID 113427829) has the molecular formula C10H9FN2O5S and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-[2-(3-fluoro-4-nitroanilino)-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-(3-fluoro-4-nitroanilino)-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 113427829 |
| Molecular Formula | C10H9FN2O5S |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-[2-(3-fluoro-4-nitroanilino)-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)Nc1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C10H9FN2O5S/c11-7-3-6(1-2-8(7)13(17)18)12-9(14)4-19-5-10(15)16/h1-3H,4-5H2,(H,12,14)(H,15,16) |
| InChIKey | IKMUJGPHCBQCLZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|