C13H10BrFN2O2 — CID 113428182
2-(5-bromopyrimidin-4-yl)-3-(3-fluorophenyl)propanoic acid (PubChem CID 113428182) has the molecular formula C13H10BrFN2O2 and a molecular weight of 325.14 g/mol. Its IUPAC name is 2-(5-bromopyrimidin-4-yl)-3-(3-fluorophenyl)propanoic acid.
| Compound Name | 2-(5-bromopyrimidin-4-yl)-3-(3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 113428182 |
| Molecular Formula | C13H10BrFN2O2 |
| Molecular Weight | 325.14 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 2-(5-bromopyrimidin-4-yl)-3-(3-fluorophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1cccc(F)c1)c1ncncc1Br |
| InChI | InChI=1S/C13H10BrFN2O2/c14-11-6-16-7-17-12(11)10(13(18)19)5-8-2-1-3-9(15)4-8/h1-4,6-7,10H,5H2,(H,18,19) |
| InChIKey | ZNPPYJHJARBIDZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |