C14H12ClFN2O3 — CID 104572728
2-(5-chloro-2-methoxypyrimidin-4-yl)-3-(3-fluorophenyl)propanoic acid (PubChem CID 104572728) has the molecular formula C14H12ClFN2O3 and a molecular weight of 310.71 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxypyrimidin-4-yl)-3-(3-fluorophenyl)propanoic acid.
| Compound Name | 2-(5-chloro-2-methoxypyrimidin-4-yl)-3-(3-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 104572728 |
| Molecular Formula | C14H12ClFN2O3 |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-(5-chloro-2-methoxypyrimidin-4-yl)-3-(3-fluorophenyl)propanoic acid |
| SMILES | COc1ncc(Cl)c(C(Cc2cccc(F)c2)C(=O)O)n1 |
| InChI | InChI=1S/C14H12ClFN2O3/c1-21-14-17-7-11(15)12(18-14)10(13(19)20)6-8-3-2-4-9(16)5-8/h2-5,7,10H,6H2,1H3,(H,19,20) |
| InChIKey | GLTSVHXXKVIOIR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |