About N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine
N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 113429645) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine.
Molecular Properties
| Compound Name | N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine |
| PubChem CID | 113429645 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(NC2CCCCCCC2)CO1 |
| InChI | InChI=1S/C14H27NO2/c1-14(2)16-10-13(11-17-14)15-12-8-6-4-3-5-7-9-12/h12-13,15H,3-11H2,1-2H3 |
| InChIKey | JRPHCWVEMFDJIT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine?
The IUPAC name of N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine (CID 113429645) is N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine.
What is the SMILES notation for N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine?
The canonical SMILES for N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine is CC1(C)OCC(NC2CCCCCCC2)CO1.
What is the InChIKey of N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine?
The InChIKey is JRPHCWVEMFDJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-14(2)16-10-13(11-17-14)15-12-8-6-4-3-5-7-9-12/h12-13,15H,3-11H2,1-2H3.
What are the key properties of N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine?
N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine has a molecular weight of 241.37 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclooctyl-2,2-dimethyl-1,3-dioxan-5-amine is sourced from PubChem (CID 113429645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).