C10H17N3O3S — CID 113433748
N-(5-ethyl-1H-pyrazol-3-yl)-2-methyl-2-methylsulfonylpropanamide (PubChem CID 113433748) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-(5-ethyl-1H-pyrazol-3-yl)-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | N-(5-ethyl-1H-pyrazol-3-yl)-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 113433748 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(5-ethyl-1H-pyrazol-3-yl)-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CCc1cc(NC(=O)C(C)(C)S(C)(=O)=O)n[nH]1 |
| InChI | InChI=1S/C10H17N3O3S/c1-5-7-6-8(13-12-7)11-9(14)10(2,3)17(4,15)16/h6H,5H2,1-4H3,(H2,11,12,13,14) |
| InChIKey | LTGDXVSQKBMQLM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |