C14H19Br2NO — CID 113441467
2-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-methylpyrrolidine (PubChem CID 113441467) has the molecular formula C14H19Br2NO and a molecular weight of 377.12 g/mol. Its IUPAC name is 2-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-methylpyrrolidine.
| Compound Name | 2-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-methylpyrrolidine |
|---|---|
| PubChem CID | 113441467 |
| Molecular Formula | C14H19Br2NO |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 2-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-methylpyrrolidine |
| SMILES | CCOc1c(Br)cc(CC2(C)CCCN2)cc1Br |
| InChI | InChI=1S/C14H19Br2NO/c1-3-18-13-11(15)7-10(8-12(13)16)9-14(2)5-4-6-17-14/h7-8,17H,3-6,9H2,1-2H3 |
| InChIKey | COQAGVXJHDPJLM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |