C15H13FN2O — CID 113442142
N-(2,3-dihydro-1H-inden-2-yl)-6-fluoropyridine-2-carboxamide (PubChem CID 113442142) has the molecular formula C15H13FN2O and a molecular weight of 256.28 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-6-fluoropyridine-2-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 113442142 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-6-fluoropyridine-2-carboxamide |
| SMILES | O=C(NC1Cc2ccccc2C1)c1cccc(F)n1 |
| InChI | InChI=1S/C15H13FN2O/c16-14-7-3-6-13(18-14)15(19)17-12-8-10-4-1-2-5-11(10)9-12/h1-7,12H,8-9H2,(H,17,19) |
| InChIKey | KPOPUNDKHXHOKF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|